Products 1807367-80-1
CAS 1807367-80-1 is the registry number for Minodronic Acid-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 1mg, 5mg.
[1-hydroxy-1-phosphono-2-(5,6,7,8-tetradeuterioimidazo[1,2-a]pyridin-3-yl)ethyl]phosphonic acid (CAS 1807367-80-1) is a chemical compound with the molecular formula C9H12N2O7P2 and a molecular weight of 326.17 g/mol. IUPAC name: [1-hydroxy-1-phosphono-2-(5,6,7,8-tetradeuterioimidazo[1,2-a]pyridin-3-yl)ethyl]phosphonic acid. InChIKey: VMMKGHQPQIEGSQ-RHQRLBAQSA-N.
| Molecular formula | C9H12N2O7P2 |
|---|---|
| Molecular weight | 326.17 g/mol |
| IUPAC name | [1-hydroxy-1-phosphono-2-(5,6,7,8-tetradeuterioimidazo[1,2-a]pyridin-3-yl)ethyl]phosphonic acid |
| InChIKey | VMMKGHQPQIEGSQ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C2=NC=C(N2C(=C1[2H])[2H])CC(O)(P(=O)(O)O)P(=O)(O)O)[2H] |
Computed by PubChem (NCBI)