CAS 127773-86-8 appears in our catalog under these names: 5,5'-Di(pyridin-4-yl)-2,2'-bithiophene, 95%, 95%, 5,5'-Di(pyridin-4-yl)-2,2'-bithiophene, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[5-(5-pyridin-4-ylthiophen-2-yl)thiophen-2-yl]pyridine (CAS 127773-86-8) is a chemical compound with the molecular formula C18H12N2S2 and a molecular weight of 320.4 g/mol. IUPAC name: 4-[5-(5-pyridin-4-ylthiophen-2-yl)thiophen-2-yl]pyridine. InChIKey: NQEJMPCAZVUWND-UHFFFAOYSA-N.
| Molecular formula | C18H12N2S2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 4-[5-(5-pyridin-4-ylthiophen-2-yl)thiophen-2-yl]pyridine |
| InChIKey | NQEJMPCAZVUWND-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC=C(S2)C3=CC=C(S3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)