CAS 182631-76-1 is the registry number for 5,5'–Di(thiophen–2–yl)–2,2'–bipyridine. Offered by: GLPBio. Available pack sizes: 1g.
5-thiophen-2-yl-2-(5-thiophen-2-yl-2-pyridinyl)pyridine (CAS 182631-76-1) is a chemical compound with the molecular formula C18H12N2S2 and a molecular weight of 320.4 g/mol. IUPAC name: 5-thiophen-2-yl-2-(5-thiophen-2-yl-2-pyridinyl)pyridine. InChIKey: FBTMQCBISODSPK-UHFFFAOYSA-N.
| Molecular formula | C18H12N2S2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 5-thiophen-2-yl-2-(5-thiophen-2-yl-2-pyridinyl)pyridine |
| InChIKey | FBTMQCBISODSPK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CN=C(C=C2)C3=NC=C(C=C3)C4=CC=CS4 |
Computed by PubChem (NCBI)