Products 127810-79-1
CAS 127810-79-1 appears in our catalog under these names: Benzyl DC–81, Benzyl DC-81, 98%, 98%, Benzyl DC-81, 95.80%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 50 mg, 25 mg.
(6aS)-2-methoxy-3-phenylmethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (CAS 127810-79-1) is a chemical compound with the molecular formula C20H20N2O3 and a molecular weight of 336.4 g/mol. IUPAC name: (6aS)-2-methoxy-3-phenylmethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one. InChIKey: PXXBSLZVZRNTAD-HNNXBMFYSA-N.
| Molecular formula | C20H20N2O3 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (6aS)-2-methoxy-3-phenylmethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| InChIKey | PXXBSLZVZRNTAD-HNNXBMFYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)N3CCC[C@H]3C=N2)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)