CAS 133550-41-1 appears in our catalog under these names: (E)-AG 556, AG 556, AG 556, 98%, 98%, (E)-AG 556, 99.91%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 250mg.
(E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(4-phenylbutyl)prop-2-enamide (CAS 133550-41-1) is a chemical compound with the molecular formula C20H20N2O3 and a molecular weight of 336.4 g/mol. IUPAC name: (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(4-phenylbutyl)prop-2-enamide. InChIKey: GWCNJMUSWLTSCW-SFQUDFHCSA-N.
| Molecular formula | C20H20N2O3 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(4-phenylbutyl)prop-2-enamide |
| InChIKey | GWCNJMUSWLTSCW-SFQUDFHCSA-N |
| SMILES | C1=CC=C(C=C1)CCCCNC(=O)/C(=C/C2=CC(=C(C=C2)O)O)/C#N |
Computed by PubChem (NCBI)