CAS 1278585-70-8 appears in our catalog under these names: Dronedarone Impurity 19, Dronedarone Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-butyl-3-(4-hydroxybenzoyl)-1-benzofuran-5-yl]methanesulfonamide (CAS 1278585-70-8) is a chemical compound with the molecular formula C20H21NO5S and a molecular weight of 387.5 g/mol. IUPAC name: N-[2-butyl-3-(4-hydroxybenzoyl)-1-benzofuran-5-yl]methanesulfonamide. InChIKey: WKFHEWCOYQNAQR-UHFFFAOYSA-N.
| Molecular formula | C20H21NO5S |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | N-[2-butyl-3-(4-hydroxybenzoyl)-1-benzofuran-5-yl]methanesulfonamide |
| InChIKey | WKFHEWCOYQNAQR-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C2=C(O1)C=CC(=C2)NS(=O)(=O)C)C(=O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)