CAS 76265-70-8 appears in our catalog under these names: Fmoc–Met(O)–OH, Fmoc-L-Met(O)-OH, N-Fmoc-L-methionine sulfoxide, 98% , Fmoc-Met(O)-OH 95%, FMOC-MET(O)-OH, 95%, 95%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfinylbutanoic acid (CAS 76265-70-8) is a chemical compound with the molecular formula C20H21NO5S and a molecular weight of 387.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfinylbutanoic acid. InChIKey: CEHRSUBRZOGRSW-HSYKDVHTSA-N.
| Molecular formula | C20H21NO5S |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfinylbutanoic acid |
| InChIKey | CEHRSUBRZOGRSW-HSYKDVHTSA-N |
| SMILES | CS(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)