CAS 127892-81-3 appears in our catalog under these names: 2-Phenylpyrimidin-4-ol, 97%, 2-Phenylpyrimidin-4(3H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-phenyl-1H-pyrimidin-6-one (CAS 127892-81-3) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 2-phenyl-1H-pyrimidin-6-one. InChIKey: JJXBLRJIMBFLMY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 2-phenyl-1H-pyrimidin-6-one |
| InChIKey | JJXBLRJIMBFLMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CC(=O)N2 |
Computed by PubChem (NCBI)