Products 1279011-16-3
CAS 1279011-16-3 is the registry number for 12-Bromo-9H-dibenzo[a,c]carbazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
17-bromo-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaene (CAS 1279011-16-3) is a chemical compound with the molecular formula C20H12BrN and a molecular weight of 346.2 g/mol. IUPAC name: 17-bromo-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaene. InChIKey: HPNBCGKHGLWWJA-UHFFFAOYSA-N.
| Molecular formula | C20H12BrN |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 17-bromo-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaene |
| InChIKey | HPNBCGKHGLWWJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=C2C5=C(N4)C=CC(=C5)Br |
Computed by PubChem (NCBI)