Products 1646272-74-3
CAS 1646272-74-3 is the registry number for 5-Bromo-7H-dibenzo[c,g]carbazole, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
9-bromo-12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene (CAS 1646272-74-3) is a chemical compound with the molecular formula C20H12BrN and a molecular weight of 346.2 g/mol. IUPAC name: 9-bromo-12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene. InChIKey: LAVSZGLUAFHKSD-UHFFFAOYSA-N.
| Molecular formula | C20H12BrN |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 9-bromo-12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
| InChIKey | LAVSZGLUAFHKSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(N3)C=C(C5=CC=CC=C54)Br |
Computed by PubChem (NCBI)