Products 1279039-06-3

CAS 1279039-06-3 appears in our catalog under these names: N-Acetyl-S-methyl-L-cysteine-d3, >95% (HPLC), N–Acetyl–S–methyl–L–cysteine–d3, N-Acetyl-S-methyl-L-cysteine-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.

Structural formula: {0} (CAS {1})

(2R)-2-acetamido-3-(trideuteriomethylsulfanyl)propanoic acid (CAS 1279039-06-3) is a chemical compound with the molecular formula C6H11NO3S and a molecular weight of 180.24 g/mol. IUPAC name: (2R)-2-acetamido-3-(trideuteriomethylsulfanyl)propanoic acid. InChIKey: RYGLCORNOFFGTB-OJWMFZEYSA-N.

Identity
Molecular formulaC6H11NO3S
Molecular weight180.24 g/mol
IUPAC name(2R)-2-acetamido-3-(trideuteriomethylsulfanyl)propanoic acid
InChIKeyRYGLCORNOFFGTB-OJWMFZEYSA-N
SMILES[2H]C([2H])([2H])SC[C@@H](C(=O)O)NC(=O)C

Computed by PubChem (NCBI)