CAS 127920-19-8 appears in our catalog under these names: 3-Amino-7-bromo-3,4-dihydroquinolin-2(1H)-one hydrochloride, 95+%, 3-Amino-7-bromo-1,2,3,4-tetrahydroquinolin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-7-bromo-3,4-dihydro-1H-quinolin-2-one;hydrochloride (CAS 127920-19-8) is a chemical compound with the molecular formula C9H10BrClN2O and a molecular weight of 277.54 g/mol. IUPAC name: 3-amino-7-bromo-3,4-dihydro-1H-quinolin-2-one;hydrochloride. InChIKey: JEYGZJHIWLHSJS-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClN2O |
|---|---|
| Molecular weight | 277.54 g/mol |
| IUPAC name | 3-amino-7-bromo-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| InChIKey | JEYGZJHIWLHSJS-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC2=C1C=CC(=C2)Br)N.Cl |
Computed by PubChem (NCBI)