CAS 1914959-47-9 is the registry number for 8-Bromo-2,3-dihydrobenzo[f][1,4]oxazepin-5-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-2,3-dihydro-1,4-benzoxazepin-5-amine;hydrochloride (CAS 1914959-47-9) is a chemical compound with the molecular formula C9H10BrClN2O and a molecular weight of 277.54 g/mol. IUPAC name: 8-bromo-2,3-dihydro-1,4-benzoxazepin-5-amine;hydrochloride. InChIKey: AEXFENNWPYZXMF-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClN2O |
|---|---|
| Molecular weight | 277.54 g/mol |
| IUPAC name | 8-bromo-2,3-dihydro-1,4-benzoxazepin-5-amine;hydrochloride |
| InChIKey | AEXFENNWPYZXMF-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2)Br)C(=N1)N.Cl |
Computed by PubChem (NCBI)