Products 127958-10-5
CAS 127958-10-5 appears in our catalog under these names: 2–Methyl–4–phenylpyrimidine–5–carboxylic acid, 2-Methyl-4-phenyl-5-pyrimidinecarboxylic acid, 95%, 2-Methyl-4-phenyl-5-pyrimidinecarboxylic acid, 97% , 2-Methyl-4-phenylpyrimidine-5-carboxylic acid, 95%, 95%, 2-Methyl-4-phenylpyrimidine-5-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
2-methyl-4-phenylpyrimidine-5-carboxylic acid (CAS 127958-10-5) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 2-methyl-4-phenylpyrimidine-5-carboxylic acid. InChIKey: XKJAQESOTNACHT-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-methyl-4-phenylpyrimidine-5-carboxylic acid |
| InChIKey | XKJAQESOTNACHT-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=N1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)