CAS 1279868-73-3 is the registry number for (1-(4-Fluorophenyl)cyclohexyl)methanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
[1-(4-fluorophenyl)cyclohexyl]methanamine;hydrochloride (CAS 1279868-73-3) is a chemical compound with the molecular formula C13H19ClFN and a molecular weight of 243.75 g/mol. IUPAC name: [1-(4-fluorophenyl)cyclohexyl]methanamine;hydrochloride. InChIKey: PBOLETZDXHJAML-UHFFFAOYSA-N.
| Molecular formula | C13H19ClFN |
|---|---|
| Molecular weight | 243.75 g/mol |
| IUPAC name | [1-(4-fluorophenyl)cyclohexyl]methanamine;hydrochloride |
| InChIKey | PBOLETZDXHJAML-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)