CAS 1803594-75-3 is the registry number for 4-(3,5-Dimethylphenyl)-4-fluoropiperidine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(3,5-dimethylphenyl)-4-fluoropiperidine;hydrochloride (CAS 1803594-75-3) is a chemical compound with the molecular formula C13H19ClFN and a molecular weight of 243.75 g/mol. IUPAC name: 4-(3,5-dimethylphenyl)-4-fluoropiperidine;hydrochloride. InChIKey: CWZLFLOQRPYZOG-UHFFFAOYSA-N.
| Molecular formula | C13H19ClFN |
|---|---|
| Molecular weight | 243.75 g/mol |
| IUPAC name | 4-(3,5-dimethylphenyl)-4-fluoropiperidine;hydrochloride |
| InChIKey | CWZLFLOQRPYZOG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2(CCNCC2)F)C.Cl |
Computed by PubChem (NCBI)