Products 1279893-11-6

CAS 1279893-11-6 is the registry number for 2-(Ethoxycarbonyl)benzo[b]thiophene-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-ethoxycarbonyl-1-benzothiophene-4-carboxylic acid (CAS 1279893-11-6) is a chemical compound with the molecular formula C12H10O4S and a molecular weight of 250.27 g/mol. IUPAC name: 2-ethoxycarbonyl-1-benzothiophene-4-carboxylic acid. InChIKey: WQXJIVNNCYBTNF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O4S
Molecular weight250.27 g/mol
IUPAC name2-ethoxycarbonyl-1-benzothiophene-4-carboxylic acid
InChIKeyWQXJIVNNCYBTNF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C=CC=C2S1)C(=O)O

Computed by PubChem (NCBI)