CAS 850074-43-0 appears in our catalog under these names: Benzo[b]thiophene-2,6-dicarboxylic acid 2-ethyl ester, 95%, Benzo[b]thiophene-2,6-dicarboxylic acid 2-ethyl ester, 97%, 97%, BENZO[B]THIOPHENE-2,6-DICARBOXYLIC ACID 2-ETHYL ESTER, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-ethoxycarbonyl-1-benzothiophene-6-carboxylic acid (CAS 850074-43-0) is a chemical compound with the molecular formula C12H10O4S and a molecular weight of 250.27 g/mol. IUPAC name: 2-ethoxycarbonyl-1-benzothiophene-6-carboxylic acid. InChIKey: UZGXHYTXEBBFMF-UHFFFAOYSA-N.
| Molecular formula | C12H10O4S |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | 2-ethoxycarbonyl-1-benzothiophene-6-carboxylic acid |
| InChIKey | UZGXHYTXEBBFMF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)