CAS 1279894-20-0 is the registry number for cis-tert-Butyl 4-methyl-3-(methylamino)piperidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3S,4S)-4-methyl-3-(methylamino)piperidine-1-carboxylate (CAS 1279894-20-0) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl (3S,4S)-4-methyl-3-(methylamino)piperidine-1-carboxylate. InChIKey: FWTHDJLHNCEJBW-VHSXEESVSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl (3S,4S)-4-methyl-3-(methylamino)piperidine-1-carboxylate |
| InChIKey | FWTHDJLHNCEJBW-VHSXEESVSA-N |
| SMILES | C[C@H]1CCN(C[C@H]1NC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)