CAS 1312762-44-9 appears in our catalog under these names: (3R,4R)-4-Methyl-3-methylamino-piperidine-1-carboxylic acid tert-butyl ester, 95%, (3R,4R)-tert-Butyl 4-methyl-3-(methylamino)piperidine-1-carboxylate, 97%, (3R,4R)-4-Methyl-3-methylamino-piperidine-1-carboxylic acid tert-butyl ester, 97%, 97%, (3R,4R)-4-METHYL-3-METHYLAMINO-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 100mg, 500mg.
Tert-butyl (3R,4R)-4-methyl-3-(methylamino)piperidine-1-carboxylate (CAS 1312762-44-9) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl (3R,4R)-4-methyl-3-(methylamino)piperidine-1-carboxylate. InChIKey: FWTHDJLHNCEJBW-ZJUUUORDSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-methyl-3-(methylamino)piperidine-1-carboxylate |
| InChIKey | FWTHDJLHNCEJBW-ZJUUUORDSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1NC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)