CAS 128-44-9 appears in our catalog under these names: Saccharin Sodium, Saccharin sodium, Saccharin sodium salt, 99.00%, Saccharin (sodium), 99.90%, Saccharin (sodium) (Standard). Offered by: Mikromol, Dr. Ehrenstorfer, GLPBio, Chemat, Biosynth. Available pack sizes: 500mg, 250mg, 100g, 1kg, 250g, 500g, 25kg, 5 g.
Sodium 1,1-dioxo-1,2-benzothiazol-2-id-3-one (CAS 128-44-9) is a chemical compound with the molecular formula C7H4NNaO3S and a molecular weight of 205.17 g/mol. IUPAC name: sodium 1,1-dioxo-1,2-benzothiazol-2-id-3-one. InChIKey: WINXNKPZLFISPD-UHFFFAOYSA-M.
| Molecular formula | C7H4NNaO3S |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | sodium 1,1-dioxo-1,2-benzothiazol-2-id-3-one |
| InChIKey | WINXNKPZLFISPD-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=O)[N-]S2(=O)=O.[Na+] |
Computed by PubChem (NCBI)