CAS 244061-22-1 is the registry number for 4-Cyanobenzenesulfonic acid sodium. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g.
Sodium 4-cyanobenzenesulfonate (CAS 244061-22-1) is a chemical compound with the molecular formula C7H4NNaO3S and a molecular weight of 205.17 g/mol. IUPAC name: sodium 4-cyanobenzenesulfonate. InChIKey: CYJUIOBSGSDQNJ-UHFFFAOYSA-M.
| Molecular formula | C7H4NNaO3S |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | sodium 4-cyanobenzenesulfonate |
| InChIKey | CYJUIOBSGSDQNJ-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C#N)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)