CAS 1280786-89-1 is the registry number for 4-Bromo-N-butyl-5-ethoxy-2-nitroaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-bromo-N-butyl-5-ethoxy-2-nitroaniline (CAS 1280786-89-1) is a chemical compound with the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. IUPAC name: 4-bromo-N-butyl-5-ethoxy-2-nitroaniline. InChIKey: RIJGVEMBLMAOLV-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O3 |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | 4-bromo-N-butyl-5-ethoxy-2-nitroaniline |
| InChIKey | RIJGVEMBLMAOLV-UHFFFAOYSA-N |
| SMILES | CCCCNC1=CC(=C(C=C1[N+](=O)[O-])Br)OCC |
Computed by PubChem (NCBI)