CAS 2126088-15-9 appears in our catalog under these names: (R)-tert-Butyl (1-(5-bromopyridin-2-yl)-2-hydroxyethyl)carbamate, 95%, (R)–tert–Butyl (1–(5–bromopyridin–2–yl)–2–hydroxyethyl)carbamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl N-[(1R)-1-(5-bromo-2-pyridinyl)-2-hydroxyethyl]carbamate (CAS 2126088-15-9) is a chemical compound with the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(5-bromo-2-pyridinyl)-2-hydroxyethyl]carbamate. InChIKey: HMFGXAHOXMEWQU-JTQLQIEISA-N.
| Molecular formula | C12H17BrN2O3 |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(5-bromo-2-pyridinyl)-2-hydroxyethyl]carbamate |
| InChIKey | HMFGXAHOXMEWQU-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)