CAS 1280787-03-2 is the registry number for Fmoc-beta-Phe(4-OMe)-OH (S). Offered by: Iris Biotech. Available pack sizes: 1g, 250mg.
(2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-methoxyphenyl)propanoic acid (CAS 1280787-03-2) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-methoxyphenyl)propanoic acid. InChIKey: DARFAJVWLQEHMQ-JOCHJYFZSA-N.
| Molecular formula | C25H23NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-methoxyphenyl)propanoic acid |
| InChIKey | DARFAJVWLQEHMQ-JOCHJYFZSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H](CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)