Products 1280802-52-9
CAS 1280802-52-9 is the registry number for 1-Phenyl-6-(pyrrolidin-1-ylmethyl)-1H-pyrazolo(3,4-d)pyrimidin-4(7H)-one. Offered by: TRC. Available pack sizes: 100mg.
1-phenyl-6-(pyrrolidin-1-ylmethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1280802-52-9) is a chemical compound with the molecular formula C16H17N5O and a molecular weight of 295.34 g/mol. IUPAC name: 1-phenyl-6-(pyrrolidin-1-ylmethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: CPDNLLYQSLBYSU-UHFFFAOYSA-N.
| Molecular formula | C16H17N5O |
|---|---|
| Molecular weight | 295.34 g/mol |
| IUPAC name | 1-phenyl-6-(pyrrolidin-1-ylmethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | CPDNLLYQSLBYSU-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=NC3=C(C=NN3C4=CC=CC=C4)C(=O)N2 |
Computed by PubChem (NCBI)