CAS 882231-37-0 is the registry number for 6-Methyl-2-{3-methyl-5-((4-methylphenyl)amino)-1H-pyrazol-1-yl}-1,4-dihydropyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-methyl-2-[3-methyl-5-(4-methylanilino)pyrazol-1-yl]-1H-pyrimidin-6-one (CAS 882231-37-0) is a chemical compound with the molecular formula C16H17N5O and a molecular weight of 295.34 g/mol. IUPAC name: 4-methyl-2-[3-methyl-5-(4-methylanilino)pyrazol-1-yl]-1H-pyrimidin-6-one. InChIKey: XIJOBJBWOPBBNG-UHFFFAOYSA-N.
| Molecular formula | C16H17N5O |
|---|---|
| Molecular weight | 295.34 g/mol |
| IUPAC name | 4-methyl-2-[3-methyl-5-(4-methylanilino)pyrazol-1-yl]-1H-pyrimidin-6-one |
| InChIKey | XIJOBJBWOPBBNG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC(=NN2C3=NC(=CC(=O)N3)C)C |
Computed by PubChem (NCBI)