CAS 128094-16-6 is the registry number for 4-Bromonaphthalene-1,8-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromonaphthalene-1,8-diamine (CAS 128094-16-6) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 4-bromonaphthalene-1,8-diamine. InChIKey: LZTGOZGWRIVART-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 4-bromonaphthalene-1,8-diamine |
| InChIKey | LZTGOZGWRIVART-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C(=C1)N)N)Br |
Computed by PubChem (NCBI)