CAS 1281662-04-1 is the registry number for 5-(5-Isoxazolyl)-2-methoxybenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methoxy-5-(1,2-oxazol-5-yl)benzenesulfonyl chloride (CAS 1281662-04-1) is a chemical compound with the molecular formula C10H8ClNO4S and a molecular weight of 273.69 g/mol. IUPAC name: 2-methoxy-5-(1,2-oxazol-5-yl)benzenesulfonyl chloride. InChIKey: PPVDVJWXLYNXHH-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO4S |
|---|---|
| Molecular weight | 273.69 g/mol |
| IUPAC name | 2-methoxy-5-(1,2-oxazol-5-yl)benzenesulfonyl chloride |
| InChIKey | PPVDVJWXLYNXHH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=NO2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)