Products 4403-36-5

CAS 4403-36-5 appears in our catalog under these names: 2-Phthalimidoethanesulfonyl chloride, 2-Phthalimidoethanesulfonyl Chloride, >98.0%(T), 2-(1,3-Dioxoisoindolin-2-yl)ethanesulfonylchloride 97%, 2-Phthalimidoethanesulfonyl chloride, 97%. Offered by: TRC, TCI, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g.

Structural formula: {0} (CAS {1})

2-(1,3-dioxoisoindol-2-yl)ethanesulfonyl chloride (CAS 4403-36-5) is a chemical compound with the molecular formula C10H8ClNO4S and a molecular weight of 273.69 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)ethanesulfonyl chloride. InChIKey: HCPVYBCAYPMANM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClNO4S
Molecular weight273.69 g/mol
IUPAC name2-(1,3-dioxoisoindol-2-yl)ethanesulfonyl chloride
InChIKeyHCPVYBCAYPMANM-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CCS(=O)(=O)Cl

Computed by PubChem (NCBI)