CAS 1281759-10-1 is the registry number for Cis-4-(chloroacetyl)-2,6-dimethylmorpholine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-chloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone (CAS 1281759-10-1) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 2-chloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone. InChIKey: SMTSEWHPTUIWBY-KNVOCYPGSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 2-chloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone |
| InChIKey | SMTSEWHPTUIWBY-KNVOCYPGSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C(=O)CCl |
Computed by PubChem (NCBI)