Products 1281872-58-9
CAS 1281872-58-9 appears in our catalog under these names: 2,3-Dihydro-alpha-methyl-6-benzofuranethanamine Hydrochloride, 6-APDB.HCl, 1mg/ml in Methanol (as free base), 6–APDB (hydrochloride), 1-(2,3-Dihydro-1-benzofuran-6-yl)propan-2-amine hydrochloride, 6-APDB (hydrochloride). Offered by: TRC, Lipomed, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 500mg, 1ml, 1mg, 10mg, 5mg, 25mg, 50mg, 10 mg.
1-(2,3-dihydro-1-benzofuran-6-yl)propan-2-amine;hydrochloride (CAS 1281872-58-9) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 1-(2,3-dihydro-1-benzofuran-6-yl)propan-2-amine;hydrochloride. InChIKey: WDSLGCCKLAJZGJ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 1-(2,3-dihydro-1-benzofuran-6-yl)propan-2-amine;hydrochloride |
| InChIKey | WDSLGCCKLAJZGJ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(CCO2)C=C1)N.Cl |
Computed by PubChem (NCBI)