CAS 1281903-88-5 is the registry number for 1-(Biphenyl-4-yl)-3,5-dimethyl-1H-pyrazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
3,5-dimethyl-1-(4-phenylphenyl)pyrazole (CAS 1281903-88-5) is a chemical compound with the molecular formula C17H16N2 and a molecular weight of 248.32 g/mol. IUPAC name: 3,5-dimethyl-1-(4-phenylphenyl)pyrazole. InChIKey: XIYOMDPMMJHYDV-UHFFFAOYSA-N.
| Molecular formula | C17H16N2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 3,5-dimethyl-1-(4-phenylphenyl)pyrazole |
| InChIKey | XIYOMDPMMJHYDV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)