CAS 190437-55-9 is the registry number for [2-(2-Quinolin-2-ylethyl)phenyl]amine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-(2-quinolin-2-ylethyl)aniline (CAS 190437-55-9) is a chemical compound with the molecular formula C17H16N2 and a molecular weight of 248.32 g/mol. IUPAC name: 2-(2-quinolin-2-ylethyl)aniline. InChIKey: FZBCGHASKLJZGH-UHFFFAOYSA-N.
| Molecular formula | C17H16N2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 2-(2-quinolin-2-ylethyl)aniline |
| InChIKey | FZBCGHASKLJZGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)CCC3=CC=CC=C3N |
Computed by PubChem (NCBI)