Products 1283352-51-1
CAS 1283352-51-1 appears in our catalog under these names: 1-((4-Ethylphenyl)methyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid, 95%, 1-((4-Ethylphenyl)methyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[(4-ethylphenyl)methyl]-5-methyltriazole-4-carboxylic acid (CAS 1283352-51-1) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: 1-[(4-ethylphenyl)methyl]-5-methyltriazole-4-carboxylic acid. InChIKey: QOWLSJFXOKZDFB-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 1-[(4-ethylphenyl)methyl]-5-methyltriazole-4-carboxylic acid |
| InChIKey | QOWLSJFXOKZDFB-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)CN2C(=C(N=N2)C(=O)O)C |
Computed by PubChem (NCBI)