Products 1283678-39-6
CAS 1283678-39-6 is the registry number for 5-(3,5-Dimethyl-1H-pyrazol-1-yl)-2-(propan-2-yl)pyrimidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(3,5-dimethylpyrazol-1-yl)-2-propan-2-ylpyrimidine-4-carboxylic acid (CAS 1283678-39-6) is a chemical compound with the molecular formula C13H16N4O2 and a molecular weight of 260.29 g/mol. IUPAC name: 5-(3,5-dimethylpyrazol-1-yl)-2-propan-2-ylpyrimidine-4-carboxylic acid. InChIKey: FHKXNXXELSHYMN-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O2 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 5-(3,5-dimethylpyrazol-1-yl)-2-propan-2-ylpyrimidine-4-carboxylic acid |
| InChIKey | FHKXNXXELSHYMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CN=C(N=C2C(=O)O)C(C)C)C |
Computed by PubChem (NCBI)