CAS 1284487-51-9 appears in our catalog under these names: Cabotegravir Impurity 10, N-((2,4-Difluorophenyl)methyl)-2,4-difluoro-benzenemethanamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
1-(2,4-difluorophenyl)-N-[(2,4-difluorophenyl)methyl]methanamine (CAS 1284487-51-9) is a chemical compound with the molecular formula C14H11F4N and a molecular weight of 269.24 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-N-[(2,4-difluorophenyl)methyl]methanamine. InChIKey: PTAWJKUYGXJHPS-UHFFFAOYSA-N.
| Molecular formula | C14H11F4N |
|---|---|
| Molecular weight | 269.24 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-N-[(2,4-difluorophenyl)methyl]methanamine |
| InChIKey | PTAWJKUYGXJHPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CNCC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)