CAS 332903-60-3 is the registry number for N-(4-Ethylphenyl)-2,3,5,6-tetrafluorobenzenamine. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
N-(4-ethylphenyl)-2,3,5,6-tetrafluoroaniline (CAS 332903-60-3) is a chemical compound with the molecular formula C14H11F4N and a molecular weight of 269.24 g/mol. IUPAC name: N-(4-ethylphenyl)-2,3,5,6-tetrafluoroaniline. InChIKey: FMBNMGDVELSOJQ-UHFFFAOYSA-N.
| Molecular formula | C14H11F4N |
|---|---|
| Molecular weight | 269.24 g/mol |
| IUPAC name | N-(4-ethylphenyl)-2,3,5,6-tetrafluoroaniline |
| InChIKey | FMBNMGDVELSOJQ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)NC2=C(C(=CC(=C2F)F)F)F |
Computed by PubChem (NCBI)