CAS 128454-91-1 is the registry number for 1-Bromo-4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hexane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromo-1,1,1,2,2,3,3-heptafluoro-4,4-bis(trifluoromethyl)hexane (CAS 128454-91-1) is a chemical compound with the molecular formula C8H4BrF13 and a molecular weight of 427.00 g/mol. IUPAC name: 6-bromo-1,1,1,2,2,3,3-heptafluoro-4,4-bis(trifluoromethyl)hexane. InChIKey: UVKBMPCVVMQGLN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF13 |
|---|---|
| Molecular weight | 427.00 g/mol |
| IUPAC name | 6-bromo-1,1,1,2,2,3,3-heptafluoro-4,4-bis(trifluoromethyl)hexane |
| InChIKey | UVKBMPCVVMQGLN-UHFFFAOYSA-N |
| SMILES | C(CBr)C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)