CAS 161583-34-2 appears in our catalog under these names: 1H,1H,2H,2H-Perfluorooctyl bromide, 95%, 8–Bromo–1,1,1,2,2,3,3,4,4,5,5,6,6–tridecafluorooctane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 50mg.
8-bromo-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane (CAS 161583-34-2) is a chemical compound with the molecular formula C8H4BrF13 and a molecular weight of 427.00 g/mol. IUPAC name: 8-bromo-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane. InChIKey: AJIHCPVPJZKWAJ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF13 |
|---|---|
| Molecular weight | 427.00 g/mol |
| IUPAC name | 8-bromo-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane |
| InChIKey | AJIHCPVPJZKWAJ-UHFFFAOYSA-N |
| SMILES | C(CBr)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)