CAS 1284786-05-5 is the registry number for 2-Bromo-N-(2,3,5,6-tetrafluorophenyl)propanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-(2,3,5,6-tetrafluorophenyl)propanamide (CAS 1284786-05-5) is a chemical compound with the molecular formula C9H6BrF4NO and a molecular weight of 300.05 g/mol. IUPAC name: 2-bromo-N-(2,3,5,6-tetrafluorophenyl)propanamide. InChIKey: AMEFKRYFJCUSNZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF4NO |
|---|---|
| Molecular weight | 300.05 g/mol |
| IUPAC name | 2-bromo-N-(2,3,5,6-tetrafluorophenyl)propanamide |
| InChIKey | AMEFKRYFJCUSNZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C(=CC(=C1F)F)F)F)Br |
Computed by PubChem (NCBI)