Products 2271442-94-3
CAS 2271442-94-3 appears in our catalog under these names: 2-Bromo-6-fluoro-n-methyl-3-(trifluoromethyl)benzamide, 95%, 2-Bromo-6-fluoro-N-methyl-3-(trifluoromethyl)benzamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
2-bromo-6-fluoro-N-methyl-3-(trifluoromethyl)benzamide (CAS 2271442-94-3) is a chemical compound with the molecular formula C9H6BrF4NO and a molecular weight of 300.05 g/mol. IUPAC name: 2-bromo-6-fluoro-N-methyl-3-(trifluoromethyl)benzamide. InChIKey: VEZIEXXCWRUDBN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF4NO |
|---|---|
| Molecular weight | 300.05 g/mol |
| IUPAC name | 2-bromo-6-fluoro-N-methyl-3-(trifluoromethyl)benzamide |
| InChIKey | VEZIEXXCWRUDBN-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=CC(=C1Br)C(F)(F)F)F |
Computed by PubChem (NCBI)