CAS 1284804-94-9 appears in our catalog under these names: 2,4-Dichloro-1-(4-iodophenoxymethyl)benzene, 98%, 2,4-Dichloro-1-(4-iodophenoxymethyl)benzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 2,5g, 250mg.
2,4-dichloro-1-[(4-iodophenoxy)methyl]benzene (CAS 1284804-94-9) is a chemical compound with the molecular formula C13H9Cl2IO and a molecular weight of 379.02 g/mol. IUPAC name: 2,4-dichloro-1-[(4-iodophenoxy)methyl]benzene. InChIKey: WHQSHHWVUQSSLU-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2IO |
|---|---|
| Molecular weight | 379.02 g/mol |
| IUPAC name | 2,4-dichloro-1-[(4-iodophenoxy)methyl]benzene |
| InChIKey | WHQSHHWVUQSSLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC2=C(C=C(C=C2)Cl)Cl)I |
Computed by PubChem (NCBI)