CAS 2921885-97-2 is the registry number for 1-(benzyloxy)-2,4-dichloro-3-iodobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dichloro-2-iodo-4-phenylmethoxybenzene (CAS 2921885-97-2) is a chemical compound with the molecular formula C13H9Cl2IO and a molecular weight of 379.02 g/mol. IUPAC name: 1,3-dichloro-2-iodo-4-phenylmethoxybenzene. InChIKey: HZSHEAAZFATXJH-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2IO |
|---|---|
| Molecular weight | 379.02 g/mol |
| IUPAC name | 1,3-dichloro-2-iodo-4-phenylmethoxybenzene |
| InChIKey | HZSHEAAZFATXJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)Cl)I)Cl |
Computed by PubChem (NCBI)