CAS 1284867-74-8 is the registry number for 4-Bromo-α-(4-chlorophenyl)-2-fluorobenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-bromo-2-fluorophenyl)-(4-chlorophenyl)methanol (CAS 1284867-74-8) is a chemical compound with the molecular formula C13H9BrClFO and a molecular weight of 315.56 g/mol. IUPAC name: (4-bromo-2-fluorophenyl)-(4-chlorophenyl)methanol. InChIKey: MJGNJOCUEXWVBC-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClFO |
|---|---|
| Molecular weight | 315.56 g/mol |
| IUPAC name | (4-bromo-2-fluorophenyl)-(4-chlorophenyl)methanol |
| InChIKey | MJGNJOCUEXWVBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=C(C=C(C=C2)Br)F)O)Cl |
Computed by PubChem (NCBI)