Products 1284960-73-1

CAS 1284960-73-1 appears in our catalog under these names: 3-Bromo-4-phenoxybenzene-1-sulfonyl chloride, 3-Bromo-4-phenoxybenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.

3-bromo-4-phenoxybenzenesulfonyl chloride (CAS 1284960-73-1) is a chemical compound with the molecular formula C12H8BrClO3S and a molecular weight of 347.61 g/mol. IUPAC name: 3-bromo-4-phenoxybenzenesulfonyl chloride. InChIKey: XURBYIXGZMOEFF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8BrClO3S
Molecular weight347.61 g/mol
IUPAC name3-bromo-4-phenoxybenzenesulfonyl chloride
InChIKeyXURBYIXGZMOEFF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=C(C=C(C=C2)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)