CAS 61405-25-2 appears in our catalog under these names: 4-(4-Bromophenoxy)benzenesulfonyl Chloride, 4-(4-Bromophenoxy)benzene-1-sulfonyl chloride. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 250mg.
4-(4-bromophenoxy)benzenesulfonyl chloride (CAS 61405-25-2) is a chemical compound with the molecular formula C12H8BrClO3S and a molecular weight of 347.61 g/mol. IUPAC name: 4-(4-bromophenoxy)benzenesulfonyl chloride. InChIKey: PLFIHRLMNDKZGJ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrClO3S |
|---|---|
| Molecular weight | 347.61 g/mol |
| IUPAC name | 4-(4-bromophenoxy)benzenesulfonyl chloride |
| InChIKey | PLFIHRLMNDKZGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)