CAS 128519-30-2 is the registry number for Anticancer agent 231. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-(4-chlorophenyl)-2-phenyl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline (CAS 128519-30-2) is a chemical compound with the molecular formula C23H22ClN3 and a molecular weight of 375.9 g/mol. IUPAC name: 4-[5-(4-chlorophenyl)-2-phenyl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline. InChIKey: OCLKWPRGEPXEIP-UHFFFAOYSA-N.
| Molecular formula | C23H22ClN3 |
|---|---|
| Molecular weight | 375.9 g/mol |
| IUPAC name | 4-[5-(4-chlorophenyl)-2-phenyl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
| InChIKey | OCLKWPRGEPXEIP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2CC(=NN2C3=CC=CC=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)