CAS 1864884-46-7 appears in our catalog under these names: 4-Mesityl-1,3-diphenyl-4H-1,2,4-triazol-1-ium chloride, 97%, 97%, 4-Mesityl-1,3-diphenyl-4H-1,2,4-triazol-1-ium chloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1,3-diphenyl-4-(2,4,6-trimethylphenyl)-1,2,4-triazol-4-ium chloride (CAS 1864884-46-7) is a chemical compound with the molecular formula C23H22ClN3 and a molecular weight of 375.9 g/mol. IUPAC name: 1,3-diphenyl-4-(2,4,6-trimethylphenyl)-1,2,4-triazol-4-ium chloride. InChIKey: AATOCGJXWBCQHO-UHFFFAOYSA-M.
| Molecular formula | C23H22ClN3 |
|---|---|
| Molecular weight | 375.9 g/mol |
| IUPAC name | 1,3-diphenyl-4-(2,4,6-trimethylphenyl)-1,2,4-triazol-4-ium chloride |
| InChIKey | AATOCGJXWBCQHO-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)[N+]2=CN(N=C2C3=CC=CC=C3)C4=CC=CC=C4)C.[Cl-] |
Computed by PubChem (NCBI)