Products 1864884-46-7

CAS 1864884-46-7 appears in our catalog under these names: 4-Mesityl-1,3-diphenyl-4H-1,2,4-triazol-1-ium chloride, 97%, 97%, 4-Mesityl-1,3-diphenyl-4H-1,2,4-triazol-1-ium chloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,3-diphenyl-4-(2,4,6-trimethylphenyl)-1,2,4-triazol-4-ium chloride (CAS 1864884-46-7) is a chemical compound with the molecular formula C23H22ClN3 and a molecular weight of 375.9 g/mol. IUPAC name: 1,3-diphenyl-4-(2,4,6-trimethylphenyl)-1,2,4-triazol-4-ium chloride. InChIKey: AATOCGJXWBCQHO-UHFFFAOYSA-M.

Identity
Molecular formulaC23H22ClN3
Molecular weight375.9 g/mol
IUPAC name1,3-diphenyl-4-(2,4,6-trimethylphenyl)-1,2,4-triazol-4-ium chloride
InChIKeyAATOCGJXWBCQHO-UHFFFAOYSA-M
SMILESCC1=CC(=C(C(=C1)C)[N+]2=CN(N=C2C3=CC=CC=C3)C4=CC=CC=C4)C.[Cl-]

Computed by PubChem (NCBI)