CAS 128540-52-3 appears in our catalog under these names: 2-Chloro-1-fluoro-4-(trifluoromethoxy)benzene, 95%, 1-Chloro-2-fluoro-5-(trifluoromethoxy)benzene, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
2-chloro-1-fluoro-4-(trifluoromethoxy)benzene (CAS 128540-52-3) is a chemical compound with the molecular formula C7H3ClF4O and a molecular weight of 214.54 g/mol. IUPAC name: 2-chloro-1-fluoro-4-(trifluoromethoxy)benzene. InChIKey: AFZHXCZNVAQUFH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O |
|---|---|
| Molecular weight | 214.54 g/mol |
| IUPAC name | 2-chloro-1-fluoro-4-(trifluoromethoxy)benzene |
| InChIKey | AFZHXCZNVAQUFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Cl)F |
Computed by PubChem (NCBI)